![structure of 2-[2-(4-Methoxyphenyl)-1,3-oxazol-4-yl]ethan-1-amine](https://molwiki.oss-cn-hongkong.aliyuncs.com/structure/48/1000931-48-5.svg)
2-[2-(4-Methoxyphenyl)-1,3-oxazol-4-yl]ethan-1-amine
Names and Identifiers of 1000931-48-5
CAS Number |
1000931-48-5 |
|---|---|
MDL Number |
MFCD09802184 |
IUPAC Name |
2-[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]ethanamine |
InChI |
InChI=1S/C12H14N2O2/c1-15-11-4-2-9(3-5-11)12-14-10(6-7-13)8-16-12/h2-5,8H,6-7,13H2,1H3 |
InChIKey |
WDZAPDWVDUZWOV-UHFFFAOYSA-N |
Canonical SMILES |
COC1=CC=C(C=C1)C2=NC(=CO2)CCN |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000931-48-5
Acidity coefficient |
8.68±0.10(Predicted) |
|---|---|
Boiling Point |
373.3±52.0 °C(Predicted) |
Density |
1.141±0.06 g/cm3(Predicted) |
H Bond Acceptors |
3 |
H Bond Donors |
1 |
LogP |
1.226489247 |
Molecular Formula |
C12H14N2O2 |
Molecular Weight |
218.25 |
Safety Information of 1000931-48-5
Applications of 1000931-48-5
The compound has several applications across various fields:
- Chemistry: It serves as an intermediate in synthesizing more complex organic molecules.
- Biology: It is used in studies focusing on enzyme interactions and metabolic pathways.
- Industry: This compound may be utilized in developing specialty chemicals and materials with specific properties.
Interaction Studies of 1000931-48-5
Interaction studies for 2-[2-(4-Methoxyphenyl)-1,3-oxazol-4-yl]ethan-1-amine focus on its binding affinity to various biological targets. These studies help elucidate its mechanism of action and potential therapeutic effects. The compound's unique structure allows it to interact selectively with specific enzymes or receptors, making it valuable for further research into its biological implications.
Similar CompoundsSeveral compounds share structural similarities with 2-[2-(4-Methoxyphenyl)-1,3-oxazol-4-yl]ethan-1-amine. Notable examples include:
| Compound Name | Structure | Unique Features |
|---|---|---|
| 2-(2-Phenyl-1,3-oxazol-4-yl)ethan-1-amine | C11H12N2O | Lacks the methoxy group but retains an oxazole structure |
| 1-(2,5-Dimethyl-1,3-oxazol-4-yl)ethan-1-amine hydrochloride | C10H14N2O·HCl | Contains a dimethyl substitution on the oxazole ring |
| 2-(5-Methyl-2-phenyloxazol)ethylamine | C12H13N | Features different substitutions on the oxazole ring |
Biological Activity of 1000931-48-5
Research indicates that 2-[2-(4-Methoxyphenyl)-1,3-oxazol-4-yl]ethan-1-amine may exhibit significant biological activities. It is being investigated for its potential antimicrobial and anticancer properties. The mechanism of action likely involves interactions with specific enzymes or receptors, which may modulate their activity and influence cellular processes, such as cell proliferation.