2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethanamine
Names and Identifiers of 1000931-30-5
CAS Number |
1000931-30-5 |
|---|---|
IUPAC Name |
2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethanamine |
Canonical SMILES |
CC1=CC=C(C=C1)C2=NC(=CO2)CCN |
Physical and chemical properties of 1000931-30-5
Acidity coefficient |
8.69±0.10(Predicted) |
|---|---|
Boiling Point |
347.7±44.0 °C(Predicted) |
Density |
1.102±0.06 g/cm3(Predicted) |
Molecular Formula |
C12H14N2O |
Molecular Weight |
202.25 |
Safety Information of 1000931-30-5
Applications of 1000931-30-5
2-[2-(4-Methylphenyl)-1,3-oxazol-4-yl]ethan-1-amine has diverse applications across various fields:
- Chemistry: It serves as a building block for synthesizing more complex molecules.
- Biology: The compound is explored for its potential biological activities, particularly in drug development.
- Industry: It is utilized in producing specialty chemicals and materials.
Interaction Studies of 1000931-30-5
Studies on the interactions of 2-[2-(4-Methylphenyl)-1,3-oxazol-4-yl]ethan-1-amine with biological targets have indicated its potential in modulating enzyme activity and gene expression. These interactions may provide insights into its therapeutic applications and mechanisms of action in treating diseases such as cancer.
Biological Activity of 1000931-30-5
The biological activity of 2-[2-(4-Methylphenyl)-1,3-oxazol-4-yl]ethan-1-amine has been investigated for its potential therapeutic effects. Research indicates that this compound may exhibit antimicrobial and anticancer properties. Its mechanism of action likely involves interactions with specific molecular targets, such as enzymes and receptors, which modulate biological pathways related to cell growth and proliferation.
