N-[3-(propan-2-yl)-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine
CAS No.:
1000931-14-5
M. Wt:
196.29
M. Fa:
C11H20N2O
InChI Key:
UHONYJVJCKIJFU-UHFFFAOYSA-N
Names and Identifiers of 1000931-14-5
CAS Number |
1000931-14-5 |
|---|---|
IUPAC Name |
N-(3-propan-2-yl-3-azabicyclo[3.3.1]nonan-9-ylidene)hydroxylamine |
InChI |
InChI=1S/C11H20N2O/c1-8(2)13-6-9-4-3-5-10(7-13)11(9)12-14/h8-10,14H,3-7H2,1-2H3 |
InChIKey |
UHONYJVJCKIJFU-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)N1CC2CCCC(C1)C2=NO |
Physical and chemical properties of 1000931-14-5
Molecular Formula |
C11H20N2O |
|---|---|
Molecular Weight |
196.29 |
Safety Information of 1000931-14-5
Applications of 1000931-14-5
N-[3-(propan-2-yl)-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine has potential applications in various fields:
- Medicinal Chemistry: As a precursor or intermediate in the synthesis of pharmaceuticals, particularly those targeting neurological disorders.
- Organic Synthesis: Utilized in the preparation of complex organic molecules through its reactive functional groups.
Interaction Studies of 1000931-14-5
Interaction studies involving N-[3-(propan-2-yl)-3-azabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine focus on its reactivity with biological targets and other chemical species:
- Molecular Docking Studies: These studies could reveal how this compound interacts with specific enzymes or receptors, providing insights into its potential therapeutic effects.
- Reactivity with Biological Molecules: Investigating how it reacts with proteins or nucleic acids could elucidate its mechanism of action.
