methyl 4-(4,5-dichloro-6-oxopyridazin-1(6H)-yl)benzoate
Names and Identifiers of 1000930-84-6
CAS Number |
1000930-84-6 |
|---|---|
MDL Number |
MFCD09971341 |
IUPAC Name |
methyl 4-(4,5-dichloro-6-oxopyridazin-1-yl)benzoate |
InChI |
InChI=1S/C12H8Cl2N2O3/c1-19-12(18)7-2-4-8(5-3-7)16-11(17)10(14)9(13)6-15-16/h2-6H,1H3 |
InChIKey |
FYQYEPQRYXBONA-UHFFFAOYSA-N |
Canonical SMILES |
COC(=O)C1=CC=C(C=C1)N2C(=O)C(=C(C=N2)Cl)Cl |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000930-84-6
Boiling Point |
398.6±52.0 °C(Predicted) |
|---|---|
Density |
1.47±0.1 g/cm3(Predicted) |
H Bond Acceptors |
3 |
H Bond Donors |
0 |
LogP |
2.110043387 |
Molecular Formula |
C12H8Cl2N2O3 |
Molecular Weight |
299.11 |
Safety Information of 1000930-84-6
Applications of 1000930-84-6
Methyl 4-(4,5-dichloro-6-oxo-1,6-dihydropyridazin-1-yl)benzoate has diverse applications across various fields:
Scientific Research:
- Used as a building block in organic synthesis.
Biological Research:
- Investigated for its potential therapeutic applications in treating various diseases.
Industrial
Interaction Studies of 1000930-84-6
The interaction studies of Methyl 4-(4,5-dichloro-6-oxo-1,6-dihydropyridazin-1-yl)benzoate focus on its biological effects at the molecular level. These studies aim to identify specific enzymes or receptors that the compound may inhibit or activate, which could lead to insights into its therapeutic potential.
Biological Activity of 1000930-84-6
Research indicates that Methyl 4-(4,5-dichloro-6-oxo-1,6-dihydropyridazin-1-yl)benzoate exhibits potential biological activities. It has been studied for its antimicrobial and anticancer properties. The mechanism of action likely involves interactions with specific molecular targets, potentially inhibiting certain enzymes or receptors, although detailed studies are required to fully elucidate these pathways.