Isobutyl-prop-2-ynyl-amine hydrochloride
CAS No.:
1000862-41-8
M. Wt:
147.64600
M. Fa:
C7H14ClN
InChI Key:
YWEPVZREDLYTOB-UHFFFAOYSA-N
Names and Identifiers of 1000862-41-8
CAS Number |
1000862-41-8 |
|---|---|
IUPAC Name |
2-methyl-N-prop-2-ynylpropan-1-amine;hydrochloride |
InChI |
InChI=1S/C7H13N.ClH/c1-4-5-8-6-7(2)3;/h1,7-8H,5-6H2,2-3H3;1H |
InChIKey |
YWEPVZREDLYTOB-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)CNCC#C.Cl |
Physical and chemical properties of 1000862-41-8
Exact Mass |
147.08100 |
|---|---|
LogP |
2.05810 |
Molecular Formula |
C7H14ClN |
Molecular Weight |
147.64600 |
PSA |
12.03000 |
Applications of 1000862-41-8
Isobutyl-prop-2-ynyl-amine hydrochloride finds various applications in scientific research:
- Proteomics Research: It serves as a reagent for protein labeling and modification studies.
- Biochemical Assays: Utilized in assays to study enzyme kinetics and interactions.
- Drug Development: Potential precursor in synthesizing pharmaceutical compounds targeting specific biological pathways.
Its versatility makes it valuable in both academic and industrial research settings.
Interaction Studies of 1000862-41-8
Interaction studies involving isobutyl-prop-2-ynyl-amine hydrochloride focus on its binding affinity and reactivity with biological molecules:
- Receptor Binding: Preliminary studies may assess how this compound interacts with various receptors, influencing downstream signaling pathways.
- Enzyme Inhibition/Activation: Investigations into its role as an inhibitor or activator of specific enzymes could elucidate its potential therapeutic effects.
Understanding these interactions is crucial for determining its efficacy in biological applications.