Ethyl 6,8-difluoroimidazo[1,2-A]pyridine-2-carboxylate
Names and Identifiers of 1000844-18-7
CAS Number |
1000844-18-7 |
|---|---|
MDL Number |
MFCD22631475 |
IUPAC Name |
ethyl 6,8-difluoroimidazo[1,2-a]pyridine-2-carboxylate |
InChI |
InChI=1S/C10H8F2N2O2/c1-2-16-10(15)8-5-14-4-6(11)3-7(12)9(14)13-8/h3-5H,2H2,1H3 |
InChIKey |
QLLNOXBPJKXPAQ-UHFFFAOYSA-N |
Canonical SMILES |
CCOC(=O)C1=CN2C=C(C=C(C2=N1)F)F |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000844-18-7
Density |
1.4±0.1 g/cm3 |
|---|---|
Exact Mass |
226.055389 |
Index of Refraction |
1.564 |
LogP |
2.49 |
Molecular Formula |
C10H8F2N2O2 |
Molecular Weight |
226.180 |
PSA |
43.60000 |
Storage condition |
Sealed in dry,Room Temperature |
Safety Information of 1000844-18-7
Applications of 1000844-18-7
Ethyl 6,8-difluoroimidazo[1,2-a]pyridine-2-carboxylate has potential applications in:
- Pharmaceutical Development: Its unique structure may lead to the discovery of new drugs targeting bacterial infections or cancer.
- Chemical Research: As a building block in organic synthesis, it can be used to create more complex molecules with desired biological activities.
- Material Science: Its properties may be explored for use in developing new materials or coatings.
Interaction Studies of 1000844-18-7
Interaction studies involving ethyl 6,8-difluoroimidazo[1,2-a]pyridine-2-carboxylate often focus on its binding affinity to specific biological targets. These studies help elucidate its mechanism of action and potential therapeutic uses. Techniques such as molecular docking simulations and biochemical assays are commonly employed to assess these interactions.
Biological Activity of 1000844-18-7
Compounds related to ethyl 6,8-difluoroimidazo[1,2-a]pyridine-2-carboxylate have shown promising biological activities. They may exhibit antibacterial properties by inhibiting bacterial cell division through interaction with the ftsZ protein, a crucial component of the bacterial cytoskeleton. Additionally, related compounds have been studied for their potential in treating various conditions, including cancer and inflammation.
