1-[2-(1-Piperidyl)ethyl]-1H-pyrazole-4-boronic Acid Pinacol Ester
Names and Identifiers of 1000802-51-6
CAS Number |
1000802-51-6 |
|---|---|
MDL Number |
MFCD21337776 |
IUPAC Name |
1-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]piperidine |
InChI |
InChI=1S/C16H28BN3O2/c1-15(2)16(3,4)22-17(21-15)14-12-18-20(13-14)11-10-19-8-6-5-7-9-19/h12-13H,5-11H2,1-4H3 |
InChIKey |
CUDGRVPQYNPZOL-UHFFFAOYSA-N |
Canonical SMILES |
B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCN3CCCCC3 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000802-51-6
Exact Mass |
305.22700 |
|---|---|
H Bond Acceptors |
4 |
H Bond Donors |
0 |
LogP |
1.60610 |
Molecular Formula |
C16H28BN3O2 |
Molecular Weight |
305.22300 |
PSA |
39.52000 |
Safety Information of 1000802-51-6
Applications of 1000802-51-6
The primary applications of 1-[2-(1-Piperidyl)ethyl]-1H-pyrazole-4-boronic acid pinacol ester include:
- Synthetic Intermediates: It serves as an intermediate in the synthesis of biologically active compounds.
- Pharmaceutical Development: Its unique structure allows it to be a potential candidate for drug formulation targeting various diseases.
- Material Science: The compound's reactivity makes it useful in developing new materials through organic synthesis techniques.
Interaction Studies of 1000802-51-6
Interaction studies involving 1-[2-(1-Piperidyl)ethyl]-1H-pyrazole-4-boronic acid pinacol ester focus on its binding affinity to various biological targets. These studies are crucial for understanding its mechanism of action and therapeutic potential. Investigations may include:
- Binding Studies: Assessing how well the compound binds to specific receptors or enzymes.
- Activity Assays: Evaluating its efficacy in biological systems, such as cell lines or animal models.
Such studies provide insight into its pharmacokinetics and pharmacodynamics.
Biological Activity of 1000802-51-6
The biological activity of 1-[2-(1-Piperidyl)ethyl]-1H-pyrazole-4-boronic acid pinacol ester stems from its structural components, particularly the pyrazole and piperidine moieties. Pyrazole derivatives are known for their diverse pharmacological properties, including anti-inflammatory, antipyretic, and analgesic effects. The presence of the piperidine ring may enhance its ability to interact with biological targets, potentially leading to applications in drug development.
