5-((6-Chloropyridazin-3-yl)methyl)-2-(2-fluorophenyl)-5H-imidazo[4,5-c]pyridine
CAS No.:
1000787-76-7
M. Wt:
339.75400
M. Fa:
C17H11ClFN5
InChI Key:
JQCDICGYKWTMPP-UHFFFAOYSA-N
Names and Identifiers of 1000787-76-7
CAS Number |
1000787-76-7 |
|---|---|
IUPAC Name |
5-[(6-chloropyridazin-3-yl)methyl]-2-(2-fluorophenyl)imidazo[4,5-c]pyridine |
InChI |
InChI=1S/C17H11ClFN5/c18-16-6-5-11(22-23-16)9-24-8-7-14-15(10-24)21-17(20-14)12-3-1-2-4-13(12)19/h1-8,10H,9H2 |
InChIKey |
JQCDICGYKWTMPP-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC=C(C(=C1)C2=NC3=CN(C=CC3=N2)CC4=NN=C(C=C4)Cl)F |
Physical and chemical properties of 1000787-76-7
Exact Mass |
339.06900 |
|---|---|
LogP |
3.72910 |
Molecular Formula |
C17H11ClFN5 |
Molecular Weight |
339.75400 |
PSA |
56.49000 |
Applications of 1000787-76-7
The unique structure of 5-((6-Chloropyridazin-3-yl)methyl)-2-(2-fluorophenyl)-5H-imidazo[4,5-c]pyridine suggests several potential applications:
- Pharmaceutical Development: Given its biological activity, this compound may serve as a lead compound in drug development for cancer or infectious diseases.
- Chemical Probes: Its ability to interact with biological targets makes it suitable for use as a chemical probe in biochemical research .
- Material Science: The compound's unique electronic properties could be explored in the development of new materials or sensors.
Interaction Studies of 1000787-76-7
Interaction studies involving 5-((6-Chloropyridazin-3-yl)methyl)-2-(2-fluorophenyl)-5H-imidazo[4,5-c]pyridine are essential for understanding its mechanism of action. Research typically focuses on:
- Binding Affinity: Investigating how well the compound binds to specific proteins or enzymes related to disease pathways.
- Synergistic Effects: Analyzing how this compound interacts with other therapeutic agents to enhance efficacy or reduce side effects.
Studies have shown that similar compounds can exhibit synergistic effects when combined with established drugs, highlighting their potential in combinatorial therapies .
Biological Activity of 1000787-76-7
Research indicates that compounds similar to 5-((6-Chloropyridazin-3-yl)methyl)-2-(2-fluorophenyl)-5H-imidazo[4,5-c]pyridine exhibit various biological activities, including:
- Anticancer Properties: Many imidazo derivatives have shown promise as anticancer agents due to their ability to inhibit specific cancer cell lines.
- Antimicrobial Activity: Some studies suggest that similar compounds possess antimicrobial properties against a range of pathogens.
- CNS Activity: Compounds with imidazo and pyridazine structures have been investigated for their potential effects on the central nervous system, indicating possible applications in treating neurological disorders .