2-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-4-yl)acetaldehyde
CAS No.:
1000771-62-9
M. Wt:
191.18300
M. Fa:
C10H9NO3
InChI Key:
UOOVJUTYTFJOCH-UHFFFAOYSA-N
Names and Identifiers of 1000771-62-9
CAS Number |
1000771-62-9 |
|---|---|
MDL Number |
MFCD08704592 |
IUPAC Name |
2-(3-oxo-1,4-benzoxazin-4-yl)acetaldehyde |
InChI |
InChI=1S/C10H9NO3/c12-6-5-11-8-3-1-2-4-9(8)14-7-10(11)13/h1-4,6H,5,7H2 |
InChIKey |
UOOVJUTYTFJOCH-UHFFFAOYSA-N |
Canonical SMILES |
C1C(=O)N(C2=CC=CC=C2O1)CC=O |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000771-62-9
Exact Mass |
191.05800 |
|---|---|
H Bond Acceptors |
3 |
H Bond Donors |
0 |
LogP |
0.67590 |
Molecular Formula |
C10H9NO3 |
Molecular Weight |
191.18300 |
PSA |
46.61000 |
Safety Information of 1000771-62-9
Applications of 1000771-62-9
The applications of 2-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-4-yl)acetaldehyde are diverse:
- Pharmaceutical Development: Due to its biological activities, it serves as a scaffold for designing new anticancer and antimicrobial agents.
- Material Science: Benzoxazines are also explored in polymer chemistry due to their potential as precursors for thermosetting resins.
Interaction Studies of 1000771-62-9
Interaction studies involving 2-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-4-yl)acetaldehyde typically focus on its binding affinity with biological targets:
- Enzyme Inhibition Studies: Research may involve evaluating its ability to inhibit specific enzymes related to cancer progression or microbial growth.
- Molecular Docking Simulations: Computational studies help predict how this compound interacts at the molecular level with various biological macromolecules.
Biological Activity of 1000771-62-9
Benzoxazine derivatives, including 2-(3-oxo-3,4-dihydro-2H-1,4-benzoxazin-4-yl)acetaldehyde, exhibit a wide range of biological activities:
- Anticancer Properties: Some studies have shown that benzoxazine derivatives can inhibit cancer cell proliferation and induce apoptosis in various cancer cell lines.
- Antimicrobial Activity: These compounds often demonstrate antibacterial and antifungal properties, making them potential candidates for developing new antimicrobial agents.
- Anti-inflammatory Effects: Certain benzoxazine derivatives have been reported to possess anti-inflammatory activities, contributing to their therapeutic potential in treating inflammatory diseases.
