2,2'-(Methylimino)bis(N,N-di-n-octylacetamide)
CAS No.:
1000668-90-5
M. Wt:
594.010
M. Fa:
C37H75N3O2
InChI Key:
VYQLYCLTFJDXGV-UHFFFAOYSA-N
Appearance:
Yellow Sticky Liquid
Names and Identifiers of 1000668-90-5
CAS Number |
1000668-90-5 |
|---|---|
MDL Number |
MFCD28386110 |
IUPAC Name |
2-{[(dioctylcarbamoyl)methyl](methyl)amino}-N,N-dioctylacetamide |
InChI |
InChI=1S/C37H75N3O2/c1-6-10-14-18-22-26-30-39(31-27-23-19-15-11-7-2)36(41)34-38(5)35-37(42)40(32-28-24-20-16-12-8-3)33-29-25-21-17-13-9-4/h6-35H2,1-5H3 |
InChIKey |
VYQLYCLTFJDXGV-UHFFFAOYSA-N |
Canonical SMILES |
CCCCCCCCN(CCCCCCCC)C(=O)CN(C)CC(=O)N(CCCCCCCC)CCCCCCCC |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000668-90-5
Boiling Point |
660.3±40.0 °C at 760 mmHg |
|---|---|
Density |
0.9±0.1 g/cm3 |
Exact Mass |
593.585938 |
Flash Point |
202.9±19.7 °C |
H Bond Acceptors |
3 |
H Bond Donors |
0 |
Index of Refraction |
1.476 |
LogP |
13.83 |
Molecular Formula |
C37H75N3O2 |
Molecular Weight |
594.010 |
Vapour Pressure |
0.0±2.0 mmHg at 25°C |
Safety Information of 1000668-90-5
Applications of 1000668-90-5
The primary application of 2,2'-(Methylimino)bis(N,N-di-n-octylacetamide) lies in its role as an efficient metal extractant. It is particularly effective in:
- Isolation of Technetium: The compound is utilized for extracting technetium from aqueous solutions, which is crucial for various nuclear medicine applications.
- Environmental Remediation: Potential use in extracting heavy metals from contaminated water sources.
Interaction Studies of 1000668-90-5
Interaction studies involving 2,2'-(Methylimino)bis(N,N-di-n-octylacetamide) focus on its ability to form complexes with various metal ions. These studies are essential for understanding its selectivity and efficiency as an extractant. The nature of these interactions can be explored through:
- Spectroscopic Techniques: Such as UV-Vis or NMR spectroscopy to analyze complex formation.
- Thermodynamic Studies: To assess stability constants and binding affinities with different metal ions.
Several compounds exhibit similar properties to 2,2'-(Methylimino)bis(N,N-di-n-octylacetamide), particularly in their roles as extractants or ligands. Below is a comparison highlighting their uniqueness:
| Compound Name | Molecular Formula | Molecular Weight | Key Features |
|---|---|---|---|
| 1,3-Bis(2-ethylhexyl)thiourea | C₁₂H₂₅N₃S | 241.41 g/mol | Known for extracting heavy metals; less lipophilic than MIDOA |
| Di(2-ethylhexyl)phosphoric acid | C₁₂H₂₅O₄P | 246.29 g/mol | Commonly used in solvent extraction; acidic nature aids in metal ion complexation |
| N,N-Di(n-octyl)acetamide | C₂₄H₅₁N₃O | 393.65 g/mol | Similar structure but lacks the methylimino bridge; used for various extractions |
Cas:1120-48-5
Cas:4408-64-4
