"5-Methyl-2-phenyl-oxazole-4-carboxylic acid Methyl ester
Names and Identifiers of 100063-41-0
CAS Number |
100063-41-0 |
|---|---|
IUPAC Name |
methyl 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
Canonical SMILES |
CC1=C(N=C(O1)C2=CC=CC=C2)C(=O)OC |
Physical and chemical properties of 100063-41-0
Exact Mass |
217.07400 |
|---|---|
LogP |
2.43660 |
Molecular Formula |
C12H11NO3 |
Molecular Weight |
217.22100 |
PSA |
52.33000 |
Interaction Studies of 100063-41-0
Interaction studies involving methyl 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate have focused on its binding affinity and inhibitory effects on specific enzymes like HldE kinase. These studies are crucial for understanding its mechanism of action and potential therapeutic applications against bacterial infections.
Biological Activity of 100063-41-0
Research indicates that methyl 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate exhibits significant biological activity. It has been investigated for its potential as an inhibitor of HldE kinase, which is involved in virulence in Gram-negative bacteria. Such inhibitors are valuable in developing new antimicrobial agents aimed at reducing bacterial virulence without necessarily killing the bacteria, thereby minimizing resistance development.
Cas:186581-53-3
Cas:18735-74-5
Cas:2940-19-4
Cas:18735-67-6