3-(ACETYLAMINO)-3-(4-NITROPHENYL)PROPANOIC ACID
CAS No.:
100061-23-2
M. Wt:
252.22300
M. Fa:
C11H12N2O5
InChI Key:
IGXJPNSMMOYCOC-UHFFFAOYSA-N
Names and Identifiers of 100061-23-2
CAS Number |
100061-23-2 |
|---|---|
MDL Number |
MFCD00508188 |
IUPAC Name |
3-acetamido-3-(4-nitrophenyl)propanoic acid |
InChI |
InChI=1S/C11H12N2O5/c1-7(14)12-10(6-11(15)16)8-2-4-9(5-3-8)13(17)18/h2-5,10H,6H2,1H3,(H,12,14)(H,15,16) |
InChIKey |
IGXJPNSMMOYCOC-UHFFFAOYSA-N |
Canonical SMILES |
CC(=O)NC(CC(=O)O)C1=CC=C([N+](=O)[O-])C=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 100061-23-2
Boiling Point |
545.9ºC at 760 mmHg |
|---|---|
Density |
1.363g/cm3 |
Exact Mass |
252.07500 |
Flash Point |
283.9ºC |
H Bond Acceptors |
5 |
H Bond Donors |
2 |
Index of Refraction |
1.578 |
LogP |
2.16080 |
Molecular Formula |
C11H12N2O5 |
Molecular Weight |
252.22300 |
PSA |
112.22000 |
Storage condition |
2-8°C |
Vapour Pressure |
9.47E-13mmHg at 25°C |
Safety Information of 100061-23-2
Applications of 100061-23-2
3-Acetamido-3-(4-nitrophenyl)propanoic acid finds applications across various fields:
- Pharmaceuticals: Its potential as a drug candidate due to its biological activities makes it valuable in medicinal chemistry.
- Chemical Research: Used as a reagent in organic synthesis to develop new compounds with desired properties.
- Analytical Chemistry: Serves as a standard in analytical methods for detecting similar compounds due to its distinct spectral characteristics.
Interaction Studies of 100061-23-2
Interaction studies involving 3-acetamido-3-(4-nitrophenyl)propanoic acid focus on its binding affinity with various biological targets:
- Protein Binding: Investigations into how this compound interacts with specific proteins can provide insights into its mechanism of action.
- Receptor Studies: Understanding its interaction with cellular receptors could elucidate its therapeutic potential and side effects.
These studies are crucial for assessing the compound's viability as a pharmaceutical agent.
Biological Activity of 100061-23-2
3-Acetamido-3-(4-nitrophenyl)propanoic acid exhibits notable biological activities, primarily due to its structural components:
- Antimicrobial Properties: Research indicates that derivatives of this compound may possess antimicrobial effects, making them candidates for pharmaceutical development.
- Enzyme Inhibition: The compound has been studied for its potential to inhibit specific enzymes, which could be beneficial in treating various diseases.
- Cellular Interaction: Preliminary studies suggest that it may interact with cellular pathways, influencing cell growth and apoptosis, although further research is necessary to elucidate these mechanisms fully.
