5-Chloro-1H-pyrrolo[3,2-b]pyridin-7-amine
CAS No.:
1000577-90-1
M. Wt:
167.596
M. Fa:
C7H6ClN3
InChI Key:
LRIRKYXDGGZLIU-UHFFFAOYSA-N
Names and Identifiers of 1000577-90-1
CAS Number |
1000577-90-1 |
|---|---|
MDL Number |
MFCD09878677 |
IUPAC Name |
5-chloro-1H-pyrrolo[3,2-b]pyridin-7-amine |
InChI |
InChI=1S/C7H6ClN3/c8-6-3-4(9)7-5(11-6)1-2-10-7/h1-3,10H,(H2,9,11) |
InChIKey |
LRIRKYXDGGZLIU-UHFFFAOYSA-N |
Canonical SMILES |
C1=CNC2=C1N=C(C=C2N)Cl |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000577-90-1
Boiling Point |
428.8±40.0 °C at 760 mmHg |
|---|---|
Density |
1.5±0.1 g/cm3 |
Exact Mass |
167.025024 |
Flash Point |
213.2±27.3 °C |
H Bond Acceptors |
2 |
H Bond Donors |
2 |
Index of Refraction |
1.777 |
LogP |
1.42 |
Molecular Formula |
C7H6ClN3 |
Molecular Weight |
167.596 |
PSA |
54.70000 |
Vapour Pressure |
0.0±1.0 mmHg at 25°C |
Safety Information of 1000577-90-1
Applications of 1000577-90-1
The applications of 5-Chloro-1H-pyrrolo[3,2-b]pyridin-7-amine are diverse:
- Pharmaceutical Development: Due to its inhibitory properties, it is being explored for drug development aimed at treating conditions such as peptic ulcers and certain cancers.
- Chemical Research: As a building block in organic synthesis, it serves as an intermediate for synthesizing more complex heterocyclic compounds.
- Biological Studies: Its unique structure makes it a valuable tool for studying enzyme interactions and biological pathways.
Interaction Studies of 1000577-90-1
Interaction studies have demonstrated that 5-Chloro-1H-pyrrolo[3,2-b]pyridin-7-amine can bind effectively to various biological targets. These studies often involve:
- Molecular Docking Simulations: To predict how this compound interacts with specific enzymes or receptors.
- In Vitro Assays: Evaluating its inhibitory effects on target enzymes related to gastric acid secretion and other metabolic pathways.
- Pharmacokinetic Studies: Assessing absorption, distribution, metabolism, and excretion profiles to understand its potential therapeutic efficacy.
Biological Activity of 1000577-90-1
5-Chloro-1H-pyrrolo[3,2-b]pyridin-7-amine exhibits significant biological activity, particularly as an inhibitor in various enzymatic pathways. Studies have shown that it acts as an inhibitor of gastric acid secretion, making it a candidate for treating gastrointestinal disorders. Its structure allows it to interact effectively with biological targets, potentially modulating pathways involved in cancer and inflammatory diseases.
