7-(tert-Butoxycarbonyl)-3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic acid
CAS No.:
1000576-71-5
M. Wt:
346.17700
M. Fa:
C12H16BrN3O4
InChI Key:
HBAHRFFATYWHKS-UHFFFAOYSA-N
Names and Identifiers of 1000576-71-5
CAS Number |
1000576-71-5 |
|---|---|
EC Number |
871-638-2 |
MDL Number |
MFCD09878581 |
IUPAC Name |
3-bromo-7-[(2-methylpropan-2-yl)oxycarbonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylic acid |
InChI |
InChI=1S/C12H16BrN3O4/c1-12(2,3)20-11(19)15-4-5-16-7(6-15)14-8(9(16)13)10(17)18/h4-6H2,1-3H3,(H,17,18) |
InChIKey |
HBAHRFFATYWHKS-UHFFFAOYSA-N |
Canonical SMILES |
CC(C)(C)OC(=O)N1CCN2C(=NC(=C2Br)C(=O)O)C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000576-71-5
Acidity coefficient |
0.28±0.20(Predicted) |
|---|---|
Boiling Point |
533.7±50.0 °C(Predicted) |
Density |
1.65±0.1 g/cm3(Predicted) |
Exact Mass |
345.03200 |
H Bond Acceptors |
4 |
H Bond Donors |
1 |
LogP |
2.03240 |
Molecular Formula |
C12H16BrN3O4 |
Molecular Weight |
346.17700 |
PSA |
84.66000 |
Safety Information of 1000576-71-5
Applications of 1000576-71-5
The applications of 7-(tert-butoxycarbonyl)-3-bromo-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylic acid are primarily in medicinal chemistry:
- Drug Development: Its structural characteristics make it a candidate for developing new therapeutic agents targeting cancer or infectious diseases.
- Chemical Probes: It can serve as a chemical probe in biological studies to investigate cellular mechanisms.
The versatility of this compound allows for exploration in various fields within pharmaceutical research.
Interaction Studies of 1000576-71-5
Interaction studies involving this compound focus on its binding affinity to biological targets such as enzymes or receptors. Preliminary data suggest that similar compounds can interact with:
- Kinases: Inhibiting certain kinases involved in cancer progression.
- Receptors: Modulating receptor activity linked to various physiological responses.
These interactions are crucial for understanding the compound's potential therapeutic roles and guiding future research directions.
