2-Bromo-4-(difluoromethoxy)-1-iodobenzene
Names and Identifiers of 1000575-02-9
CAS Number |
1000575-02-9 |
|---|---|
MDL Number |
MFCD09878210 |
IUPAC Name |
2-bromo-4-(difluoromethoxy)-1-iodobenzene |
InChI |
InChI=1S/C7H4BrF2IO/c8-5-3-4(12-7(9)10)1-2-6(5)11/h1-3,7H |
InChIKey |
XFABSMJJAYAEDX-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=C(C=C1OC(F)F)Br)I |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000575-02-9
Molecular Formula |
C7H4BrF2IO |
|---|---|
Molecular Weight |
348.91 |
Safety Information of 1000575-02-9
Applications of 1000575-02-9
2-Bromo-4-(difluoromethoxy)-1-iodobenzene has a variety of applications:
- Organic Synthesis: It serves as a building block for the preparation of more complex organic molecules.
- Pharmaceutical Development: The compound can be utilized in developing new pharmaceuticals due to its potential bioactivity.
- Specialty Chemicals: It is also used in producing specialty chemicals with tailored properties for specific applications.
Interaction Studies of 1000575-02-9
Interaction studies involving 2-Bromo-4-(difluoromethoxy)-1-iodobenzene primarily focus on its reactivity with nucleophiles and electrophiles in various chemical processes. Its halogen substituents play a crucial role in facilitating these interactions, making it a valuable compound for exploring reaction mechanisms in organic chemistry.
Biological Activity of 1000575-02-9
While specific biological activities of 2-Bromo-4-(difluoromethoxy)-1-iodobenzene are not extensively documented, compounds with similar structures often exhibit bioactivity. This compound may serve as a precursor in the synthesis of bioactive molecules or pharmaceuticals, potentially influencing various biological pathways through its interactions with molecular targets.
