2-Bromo-1-chloro-4-(difluoromethoxy)benzene
CAS No.:
1000574-90-2
M. Wt:
257.46000
M. Fa:
C7H4BrClF2O
InChI Key:
YPKJIEMJTXQKGI-UHFFFAOYSA-N
Names and Identifiers of 1000574-90-2
CAS Number |
1000574-90-2 |
|---|---|
MDL Number |
MFCD09878208 |
IUPAC Name |
2-bromo-1-chloro-4-(difluoromethoxy)benzene |
InChI |
InChI=1S/C7H4BrClF2O/c8-5-3-4(12-7(10)11)1-2-6(5)9/h1-3,7H |
InChIKey |
YPKJIEMJTXQKGI-UHFFFAOYSA-N |
Canonical SMILES |
FC(F)OC1=CC=C(Cl)C(Br)=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000574-90-2
Exact Mass |
255.91000 |
|---|---|
LogP |
3.70390 |
Molecular Formula |
C7H4BrClF2O |
Molecular Weight |
257.46000 |
PSA |
9.23000 |
Safety Information of 1000574-90-2
Applications of 1000574-90-2
2-Bromo-1-chloro-4-(difluoromethoxy)benzene has potential applications in various fields:
- Research: It is utilized in biochemical research, particularly in proteomics and as a tool for studying enzyme interactions.
- Pharmaceuticals: Its unique structure may lead to the development of new drugs targeting specific biological pathways.
- Materials Science: The compound could be explored for use in developing new materials with specific electronic or optical properties due to its halogenated nature.
Interaction Studies of 1000574-90-2
Interaction studies involving 2-Bromo-1-chloro-4-(difluoromethoxy)benzene typically focus on its reactivity with biological molecules or other chemical species. These studies are crucial for understanding how the compound might behave in biological systems or its potential toxicity. Research often examines:
- Binding affinity: Investigating how well the compound binds to enzymes or receptors.
- Metabolic stability: Evaluating how the compound is metabolized in biological systems and its potential degradation products.
