2-{3-[(2-methylphenyl)methoxy]phenyl}acetic acid
Names and Identifiers of 1000567-84-9
CAS Number |
1000567-84-9 |
|---|---|
MDL Number |
MFCD09925286 |
IUPAC Name |
2-{3-[(2-methylphenyl)methoxy]phenyl}acetic acid |
InChI |
InChI=1S/C16H16O3/c1-12-5-2-3-7-14(12)11-19-15-8-4-6-13(9-15)10-16(17)18/h2-9H,10-11H2,1H3,(H,17,18) |
InChIKey |
CUNXDTUAQMRCRX-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CC=CC=C1COC1=CC=CC(CC(=O)O)=C1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000567-84-9
Boiling Point |
433.3±30.0 °C(Predicted) |
|---|---|
Density |
1.176±0.06 g/cm3(Predicted) |
H Bond Acceptors |
3 |
H Bond Donors |
1 |
LogP |
3.69121734633333 |
Molecular Formula |
C16H16O3 |
Molecular Weight |
256.3 |
Safety Information of 1000567-84-9
Applications of 1000567-84-9
The primary applications of 2-{3-[(2-Methylphenyl)methoxy]phenyl}acetic acid lie in medicinal chemistry and pharmaceutical development. Its potential anti-inflammatory properties make it a candidate for drug formulation aimed at treating pain and inflammatory conditions. Additionally, its unique structure may allow for further modifications leading to novel therapeutic agents.
Interaction Studies of 1000567-84-9
Interaction studies for 2-{3-[(2-Methylphenyl)methoxy]phenyl}acetic acid focus on its binding affinity to various biological targets. Preliminary studies suggest it may interact with cyclooxygenase enzymes, similar to non-steroidal anti-inflammatory drugs (NSAIDs). Further research is necessary to elucidate its interaction profiles and mechanism of action in biological systems.
