2-(2-Chloro-6-methylpyridin-3-yl)acetic acid
CAS No.:
1000567-19-0
M. Wt:
185.61
M. Fa:
C8H8ClNO2
InChI Key:
HKYCQVRONOLJDQ-UHFFFAOYSA-N
Appearance:
Pale-yellow Solid
Names and Identifiers of 1000567-19-0
CAS Number |
1000567-19-0 |
|---|---|
IUPAC Name |
2-(2-chloro-6-methylpyridin-3-yl)acetic acid |
InChI |
InChI=1S/C8H8ClNO2/c1-5-2-3-6(4-7(11)12)8(9)10-5/h2-3H,4H2,1H3,(H,11,12) |
InChIKey |
HKYCQVRONOLJDQ-UHFFFAOYSA-N |
Canonical SMILES |
CC1=NC(=C(C=C1)CC(=O)O)Cl |
Physical and chemical properties of 1000567-19-0
Acidity coefficient |
3.89±0.10(Predicted) |
|---|---|
Boiling Point |
336.9±37.0 °C(Predicted) |
Density |
1.341±0.06 g/cm3(Predicted) |
Molecular Formula |
C8H8ClNO2 |
Molecular Weight |
185.61 |
Applications of 1000567-19-0
This compound has potential applications in various fields:
- Pharmaceuticals: As an intermediate in drug development, particularly for compounds targeting specific biological pathways.
- Research: Used in studies investigating its biological properties or as a precursor for synthesizing more complex organic molecules.
- Specialty Chemicals: Employed in the production of materials with specific chemical properties.
Biological Activity of 1000567-19-0
2-(2-Chloro-6-methylpyridin-3-yl)acetic acid exhibits biological activity that may include interactions with specific enzymes or receptors. The presence of the chloro and acetic acid groups allows for hydrogen bonding and electrostatic interactions, which could modulate the activity of target molecules, potentially leading to therapeutic effects.