2-[2-(trifluoromethyl)pyridin-3-yl]ethanol
Names and Identifiers of 1000562-95-7
CAS Number |
1000562-95-7 |
|---|---|
IUPAC Name |
2-[2-(trifluoromethyl)pyridin-3-yl]ethanol |
Canonical SMILES |
C1=CC(=C(N=C1)C(F)(F)F)CCO |
Physical and chemical properties of 1000562-95-7
Molecular Formula |
C8H8F3NO |
|---|---|
Molecular Weight |
191.15 |
Applications of 1000562-95-7
The applications of 2-[2-(Trifluoromethyl)pyridin-3-yl]ethan-1-ol span various fields:
- Chemistry: It serves as a building block for synthesizing more complex fluorinated compounds.
- Biology: Its unique properties make it useful in studying biological processes and interactions.
- Industry: The compound is utilized in producing agrochemicals and advanced materials, including fluorinated polymers.
Interaction Studies of 1000562-95-7
Studies on the interactions of 2-[2-(Trifluoromethyl)pyridin-3-yl]ethan-1-ol with biological targets reveal its potential as a modulator of enzyme activity. Its lipophilicity allows it to effectively penetrate cellular membranes, influencing various signaling pathways. Research continues to explore its pharmacological effects and therapeutic potential in treating diseases related to enzyme dysfunctions.
Biological Activity of 1000562-95-7
The biological activity of 2-[2-(Trifluoromethyl)pyridin-3-yl]ethan-1-ol is noteworthy due to its structural features. The trifluoromethyl group increases the compound's interaction with biological membranes, potentially influencing various biochemical pathways. It has been studied for its role in modulating enzyme activities and protein-ligand interactions, making it valuable in pharmacological research.