Benzeneethanol, 3-fluoro-4-(trifluoromethyl)-
Names and Identifiers of 1000560-90-6
CAS Number |
1000560-90-6 |
|---|---|
MDL Number |
MFCD09926434 |
IUPAC Name |
2-[3-fluoro-4-(trifluoromethyl)phenyl]ethanol |
InChI |
InChI=1S/C9H8F4O/c10-8-5-6(3-4-14)1-2-7(8)9(11,12)13/h1-2,5,14H,3-4H2 |
InChIKey |
IVAIIWIJJRTLNY-UHFFFAOYSA-N |
Canonical SMILES |
C1=CC(=C(C=C1CCO)F)C(F)(F)F |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1000560-90-6
Boiling Point |
222.0±35.0 °C(Predicted) |
|---|---|
Density |
1.321±0.06 g/cm3(Predicted) |
H Bond Acceptors |
1 |
H Bond Donors |
1 |
LogP |
2.51510767166667 |
Molecular Formula |
C9H8F4O |
Molecular Weight |
208.15 |
Safety Information of 1000560-90-6
Applications of 1000560-90-6
Benzeneethanol, 3-fluoro-4-(trifluoromethyl)- has diverse applications in:
- Pharmaceuticals: Used as an intermediate in the synthesis of various drugs due to its unique chemical properties.
- Agricultural Chemicals: Potential applications in developing agrochemicals that require specific bioactivity.
- Research: Employed in scientific studies to explore its biological effects and interactions with other compounds.
Interaction Studies of 1000560-90-6
Interaction studies involving benzeneethanol, 3-fluoro-4-(trifluoromethyl)- focus on its binding affinity with biological targets such as enzymes and receptors. Research indicates that fluorinated compounds often exhibit altered interaction profiles compared to their non-fluorinated counterparts. These studies are essential for understanding the compound's potential therapeutic roles and mechanisms of action.
Biological Activity of 1000560-90-6
Research indicates that benzeneethanol derivatives exhibit significant biological activities, including antimicrobial and anti-inflammatory properties. The presence of fluorine atoms often enhances the lipophilicity of these compounds, potentially increasing their bioavailability and efficacy in biological systems. Specific studies have shown that compounds with similar structures can inhibit certain enzymes or act as receptor modulators, suggesting that benzeneethanol, 3-fluoro-4-(trifluoromethyl)- may also possess such activities.