2-(5-Fluoro-6-methylpyridin-2-yl)ethan-1-ol
Names and Identifiers of 1000534-34-8
CAS Number |
1000534-34-8 |
|---|---|
IUPAC Name |
2-(5-fluoro-6-methylpyridin-2-yl)ethanol |
InChI |
InChI=1S/C8H10FNO/c1-6-8(9)3-2-7(10-6)4-5-11/h2-3,11H,4-5H2,1H3 |
InChIKey |
KWGYPLJBXABJNR-UHFFFAOYSA-N |
Canonical SMILES |
CC1=C(C=CC(=N1)CCO)F |
Physical and chemical properties of 1000534-34-8
Molecular Formula |
C8H10FNO |
|---|---|
Molecular Weight |
155.17 |
Safety Information of 1000534-34-8
Applications of 1000534-34-8
Due to its unique structure, 2-(5-Fluoro-6-methylpyridin-2-yl)ethan-1-ol has potential applications in various fields:
- Pharmaceuticals: Its biological activity suggests potential as a lead compound in drug discovery for treating infections or cancer.
- Agricultural Chemicals: The compound may serve as a precursor for developing agrochemicals with enhanced efficacy against pests or diseases.
Interaction Studies of 1000534-34-8
Interaction studies involving 2-(5-Fluoro-6-methylpyridin-2-yl)ethan-1-ol focus on its binding affinity to specific enzymes or receptors. These studies are essential for understanding the compound's mechanism of action and potential therapeutic effects. For instance, investigations into its interaction with cytochrome P450 enzymes could provide insights into its metabolic pathways and safety profiles.
Biological Activity of 1000534-34-8
Compounds containing pyridine rings often exhibit significant biological activity, including antimicrobial, anti-inflammatory, and antitumor effects. The presence of the fluorine atom in 2-(5-Fluoro-6-methylpyridin-2-yl)ethan-1-ol may enhance its pharmacological properties due to increased lipophilicity and metabolic stability. Preliminary studies suggest that derivatives of fluorinated pyridines can interact with various biological targets, influencing enzyme activity and receptor binding.