2-[2,6-difluoro-4-(trifluoromethyl)phenyl]acetic acid
CAS No.:
1000517-21-4
M. Wt:
240.13
M. Fa:
C9H5F5O2
InChI Key:
-
Names and Identifiers of 1000517-21-4
CAS Number |
1000517-21-4 |
|---|---|
IUPAC Name |
2-[2,6-bis(fluoranyl)-4-(trifluoromethyl)phenyl]ethanoic acid |
Canonical SMILES |
C1=C(C=C(C(=C1F)CC(=O)O)F)C(F)(F)F |
Physical and chemical properties of 1000517-21-4
Molecular Formula |
C9H5F5O2 |
|---|---|
Molecular Weight |
240.13 |
Applications of 1000517-21-4
2,6-Difluoro-4-(trifluoromethyl)phenylacetic acid has potential applications in several areas:
- Pharmaceuticals: Due to its unique chemical properties, it could serve as a lead compound for developing new therapeutic agents.
- Agricultural Chemicals: Its biological activity may lend itself to use in agrochemicals as herbicides or fungicides.
- Material Science: The compound's stability and unique properties make it suitable for developing advanced materials with specific functionalities.
Further research is required to explore these applications comprehensively.
Interaction Studies of 1000517-21-4
Interaction studies involving 2,6-difluoro-4-(trifluoromethyl)phenylacetic acid focus on its behavior in biological systems and its interactions with various biomolecules. Preliminary findings suggest that compounds with similar structures may interact with enzymes or receptors involved in inflammatory pathways. Understanding these interactions is crucial for assessing potential therapeutic uses and predicting side effects.