3-Amino-5-methylthiophene-2-carboxylic acid
Names and Identifiers of 100047-53-8
CAS Number |
100047-53-8 |
|---|---|
MDL Number |
MFCD18904383 |
IUPAC Name |
3-amino-5-methylthiophene-2-carboxylic acid |
InChI |
InChI=1S/C6H7NO2S/c1-3-2-4(7)5(10-3)6(8)9/h2H,7H2,1H3,(H,8,9) |
InChIKey |
BLEZJNAXCPGYTF-UHFFFAOYSA-N |
Canonical SMILES |
CC1=CC(N)=C(C(=O)O)S1 |
UNSPSC Code |
12352100 |
Physical and chemical properties of 100047-53-8
Exact Mass |
157.02000 |
|---|---|
H Bond Acceptors |
3 |
H Bond Donors |
2 |
LogP |
1.91810 |
Molecular Formula |
C6H7NO2S |
Molecular Weight |
157.19000 |
PSA |
91.56000 |
Safety Information of 100047-53-8
Applications of 100047-53-8
3-Amino-5-methylthiophene-2-carboxylic acid has a wide range of applications:
- Chemical Research: It serves as a building block for synthesizing more complex thiophene derivatives.
- Biological Research: The compound is explored for its potential therapeutic properties.
- Material Science: It is utilized in developing organic semiconductors and other advanced materials due to its electronic properties.
Interaction Studies of 100047-53-8
Research on 3-Amino-5-methylthiophene-2-carboxylic acid includes studies on its interactions with biological molecules. These studies aim to elucidate its mechanism of action, particularly how it interacts with enzymes or receptors within biological systems. Understanding these interactions can provide insights into its potential therapeutic uses and guide further research into its efficacy and safety profiles.
Biological Activity of 100047-53-8
3-Amino-5-methylthiophene-2-carboxylic acid has been investigated for its potential biological activities, particularly in the fields of antimicrobial and anticancer research. Its unique structure allows it to interact with various biological targets, potentially inhibiting enzyme activity or modulating receptor signaling pathways. This makes it a candidate for further exploration in medicinal chemistry and drug development.
Cas:76575-71-8
