methyl 3-amino-4-bromo-5-phenylthiophene-2-carboxylate
Names and Identifiers of 1000409-69-7
CAS Number |
1000409-69-7 |
|---|---|
IUPAC Name |
methyl 3-azanyl-4-bromanyl-5-phenyl-thiophene-2-carboxylate |
Canonical SMILES |
COC(=O)C1=C(C(=C(S1)C2=CC=CC=C2)Br)N |
Physical and chemical properties of 1000409-69-7
Exact Mass |
310.96200 |
|---|---|
LogP |
4.12760 |
Molecular Formula |
C12H10BrNO2S |
Molecular Weight |
312.18200 |
PSA |
80.56000 |
Applications of 1000409-69-7
Methyl 3-amino-4-bromo-5-phenylthiophene-2-carboxylate has several applications:
- Organic Synthesis: Serves as an intermediate in the synthesis of more complex organic molecules.
- Pharmaceutical Research: Investigated for its potential therapeutic applications due to its biological activity.
- Material Science: Utilized in developing materials with specific electronic properties, contributing to advancements in organic electronics.
Interaction Studies of 1000409-69-7
Studies on the interactions of methyl 3-amino-4-bromo-5-phenylthiophene-2-carboxylate focus on its binding affinity to various enzymes and receptors. Understanding these interactions helps elucidate its mechanism of action and potential therapeutic effects. The compound's ability to modulate specific biological pathways makes it an interesting subject for further research in pharmacology and medicinal chemistry.
Biological Activity of 1000409-69-7
Research into the biological activity of methyl 3-amino-4-bromo-5-phenylthiophene-2-carboxylate has indicated potential antimicrobial and anticancer properties. Its structural features allow it to interact with various biological targets, potentially modulating enzyme activities or receptor functions. This makes it a candidate for further investigation in therapeutic applications.