5,7-DIFLUORO 3-(1H) INDAZOLE CARBOALDEHYDE
Names and Identifiers of 1000343-25-8
CAS Number |
1000343-25-8 |
|---|---|
IUPAC Name |
5,7-bis(fluoranyl)-2H-indazole-3-carbaldehyde |
Canonical SMILES |
C1=C(C=C(C2=NNC(=C21)C=O)F)F |
Physical and chemical properties of 1000343-25-8
Acidity coefficient |
9.04±0.40(Predicted) |
|---|---|
Boiling Point |
354.6±37.0 °C at 760 mmHg |
Density |
1.6±0.1 g/cm3 |
Exact Mass |
182.029175 |
Flash Point |
168.3±26.5 °C |
Index of Refraction |
1.677 |
LogP |
1.18 |
Molecular Formula |
C8H4F2N2O |
Molecular Weight |
182.127 |
PSA |
45.75000 |
Vapour Pressure |
0.0±0.8 mmHg at 25°C |
Applications of 1000343-25-8
5,7-Difluoro-1H-indazole-3-carbaldehyde has diverse applications across various fields:
- Chemistry: It serves as an intermediate in synthesizing complex organic molecules and pharmaceuticals.
- Biology: The compound acts as a building block for developing biologically active compounds with potential therapeutic applications.
- Medicine: Its role in drug discovery is significant, particularly in designing enzyme inhibitors and receptor modulators.
- Industry: It is utilized in producing specialty chemicals and materials with specific properties.
Interaction Studies of 1000343-25-8
The interaction studies of 5,7-Difluoro-1H-indazole-3-carbaldehyde focus on its binding affinity to enzymes and receptors. The compound's aldehyde group can undergo various reactions leading to the formation of reactive intermediates that interact with biological molecules. This ability to modulate enzymatic activity and receptor signaling pathways highlights its potential as a therapeutic agent.
Biological Activity of 1000343-25-8
5,7-Difluoro-1H-indazole-3-carbaldehyde exhibits significant biological activity. It has been studied for its potential as an enzyme inhibitor and receptor modulator. The compound's ability to bind to specific enzymes and alter receptor signaling pathways suggests its utility in drug discovery and development. Researchers are investigating its applications in creating biologically active compounds that may have therapeutic benefits.