1-benzoyl-2-(chloromethyl)pyrrolidine
Names and Identifiers of 1-benzoyl-2-(chloromethyl)pyrrolidine
CAS Number |
1000789-60-5 |
|---|---|
MDL Number |
MFCD18350463 |
IUPAC Name |
[2-(chloromethyl)pyrrolidin-1-yl]-phenylmethanone |
InChI |
InChI=1S/C12H14ClNO/c13-9-11-7-4-8-14(11)12(15)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2 |
InChIKey |
RKPGLCOGWPVEHD-UHFFFAOYSA-N |
Canonical SMILES |
O=C(C1=CC=CC=C1)N1CCCC1CCl |
UNSPSC Code |
12352100 |
Physical and chemical properties of 1-benzoyl-2-(chloromethyl)pyrrolidine
Exact Mass |
223.07600 |
|---|---|
LogP |
2.46790 |
Molecular Formula |
C12H14ClNO |
Molecular Weight |
223.69900 |
PSA |
20.31000 |
Safety Information of 1-benzoyl-2-(chloromethyl)pyrrolidine
Applications of 1-benzoyl-2-(chloromethyl)pyrrolidine
1-Benzoyl-2-(chloromethyl)pyrrolidine has potential applications in various fields:
- Pharmaceuticals: As a precursor for synthesizing bioactive compounds that may serve as drugs targeting neurological disorders or infections.
- Chemical Research: Utilized as an intermediate in organic synthesis for developing new materials or compounds with specific properties.
- Agricultural Chemistry: Potential use in developing agrochemicals due to its reactivity and ability to form derivatives with biological activity.
Interaction Studies of 1-benzoyl-2-(chloromethyl)pyrrolidine
Studies have demonstrated that 1-benzoyl-2-(chloromethyl)pyrrolidine interacts with several biological targets. For instance, research indicates that pyrrolidine derivatives can inhibit acetylcholinesterase activity, which is crucial for neurotransmitter regulation in the nervous system . Additionally, the compound's ability to form various derivatives allows for exploration into its interactions with different enzymes and receptors.
Biological Activity of 1-benzoyl-2-(chloromethyl)pyrrolidine
The biological activity of 1-benzoyl-2-(chloromethyl)pyrrolidine is primarily attributed to the pyrrolidine moiety, which has been shown to exhibit various pharmacological properties. Pyrrolidine derivatives are known for their potential as antimicrobial agents, enzyme inhibitors, and neuroprotective agents. Recent studies have indicated that compounds containing the pyrrolidine structure can interact with biological targets such as acetylcholinesterase and butyrylcholinesterase, suggesting potential applications in treating neurodegenerative diseases .
Cas:98-88-4
